CAS 138165-77-2 appears in our catalog under these names: L-Beta-homophenylalanine hydrochloride, 98%, H–β–HoPhe–OH, H-L-beta-HPhe-OH*HCl, H-β-HoPhe-OH.HCl, 95%, 95%, H-β-HoPhe-OH.HCl, 99.65%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Chemat, MedChemExpress. Available pack sizes: 250mg, 5g, 10g, 25g, 1g, 100mg, 100g, 10 g.
(3S)-3-amino-4-phenylbutanoic acid;hydrochloride (CAS 138165-77-2) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: (3S)-3-amino-4-phenylbutanoic acid;hydrochloride. InChIKey: MQTMGKGSJOPWJW-FVGYRXGTSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | (3S)-3-amino-4-phenylbutanoic acid;hydrochloride |
| InChIKey | MQTMGKGSJOPWJW-FVGYRXGTSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)