Products 46331-50-4
CAS 46331-50-4 appears in our catalog under these names: 5-Methoxyisophthalic Acid, 5–Methoxyisophthalic Acid, 5-Methoxyisophthalic Acid, >98.0%(GC)(T), 5-Methoxyisophthalic acid 97%, 5-Methoxyisophthalic acid, 97%, 97%. Offered by: TRC, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 1g, 50g, 5g, 10g, 25g, 100g, 250mg.
5-methoxybenzene-1,3-dicarboxylic acid (CAS 46331-50-4) is a chemical compound with the molecular formula C9H8O5 and a molecular weight of 196.16 g/mol. IUPAC name: 5-methoxybenzene-1,3-dicarboxylic acid. InChIKey: POSMIIJADZKUPL-UHFFFAOYSA-N.
| Molecular formula | C9H8O5 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | 5-methoxybenzene-1,3-dicarboxylic acid |
| InChIKey | POSMIIJADZKUPL-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)