CAS 467458-98-6 appears in our catalog under these names: 3-(2,2-Difluoroethoxy)benzaldehyde, 95%, 3-(2,2-Difluoroethoxy)benzaldehyde. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 5g, 1g, 2,5g.
3-(2,2-difluoroethoxy)benzaldehyde (CAS 467458-98-6) is a chemical compound with the molecular formula C9H8F2O2 and a molecular weight of 186.15 g/mol. IUPAC name: 3-(2,2-difluoroethoxy)benzaldehyde. InChIKey: MBMWQKCLNFZJSF-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O2 |
|---|---|
| Molecular weight | 186.15 g/mol |
| IUPAC name | 3-(2,2-difluoroethoxy)benzaldehyde |
| InChIKey | MBMWQKCLNFZJSF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC(F)F)C=O |
Computed by PubChem (NCBI)