CAS 4702-29-8 is the registry number for 7-Methoxyisochroman-1,3-dione, 97%. Offered by: AmBeed. Available pack sizes: 1g.
7-methoxy-4H-isochromene-1,3-dione (CAS 4702-29-8) is a chemical compound with the molecular formula C10H8O4 and a molecular weight of 192.17 g/mol. IUPAC name: 7-methoxy-4H-isochromene-1,3-dione. InChIKey: LVVCEOLCRIPDJJ-UHFFFAOYSA-N.
| Molecular formula | C10H8O4 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 7-methoxy-4H-isochromene-1,3-dione |
| InChIKey | LVVCEOLCRIPDJJ-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(CC(=O)OC2=O)C=C1 |
Computed by PubChem (NCBI)