Products 47288-83-5
CAS 47288-83-5 is the registry number for Ceftolozane Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
(4-methoxyphenyl)methyl (6R,7R)-7-amino-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (CAS 47288-83-5) is a chemical compound with the molecular formula C16H18N2O4S and a molecular weight of 334.4 g/mol. IUPAC name: (4-methoxyphenyl)methyl (6R,7R)-7-amino-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate. InChIKey: FWMULLONXKFDBL-IUODEOHRSA-N.
| Molecular formula | C16H18N2O4S |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | (4-methoxyphenyl)methyl (6R,7R)-7-amino-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| InChIKey | FWMULLONXKFDBL-IUODEOHRSA-N |
| SMILES | CC1=C(N2[C@@H]([C@@H](C2=O)N)SC1)C(=O)OCC3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)