Products 2241054-05-5

CAS 2241054-05-5 is the registry number for 4-[(4-Butoxyphenyl)diazenyl]benzenesulfonic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

4-[(4-butoxyphenyl)diazenyl]benzenesulfonic acid (CAS 2241054-05-5) is a chemical compound with the molecular formula C16H18N2O4S and a molecular weight of 334.4 g/mol. IUPAC name: 4-[(4-butoxyphenyl)diazenyl]benzenesulfonic acid. InChIKey: CKQGTGVNQBGWGS-UHFFFAOYSA-N.

Identity
Molecular formulaC16H18N2O4S
Molecular weight334.4 g/mol
IUPAC name4-[(4-butoxyphenyl)diazenyl]benzenesulfonic acid
InChIKeyCKQGTGVNQBGWGS-UHFFFAOYSA-N
SMILESCCCCOC1=CC=C(C=C1)N=NC2=CC=C(C=C2)S(=O)(=O)O

Computed by PubChem (NCBI)