CAS 1239233-86-3 appears in our catalog under these names: 3-Descyano-3-aminocarbonyl Febuxostat , >95% (HPLC), 2-(3-Carbamoyl-4-isobutoxyphenyl)-4-methylthiazole-5-carboxylic acid, 95%, Febuxostat Impurity 4, Febuxostat Impurity 103, 2-(3-(Aminocarbonyl)-4-(2-methylpropoxy)phenyl)-4-methyl-5-thiazolecarboxylic Acid. Offered by: TRC, Combi-blocks, Chemat Brand, Biosynth, Ambeed. Available pack sizes: 100mg, 10mg, 500mg, 250mg, on request, 25mg, 50mg, 1g.
2-[3-carbamoyl-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 1239233-86-3) is a chemical compound with the molecular formula C16H18N2O4S and a molecular weight of 334.4 g/mol. IUPAC name: 2-[3-carbamoyl-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: ITMGNZBRUWAGOZ-UHFFFAOYSA-N.
| Molecular formula | C16H18N2O4S |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | 2-[3-carbamoyl-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | ITMGNZBRUWAGOZ-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CC(=C(C=C2)OCC(C)C)C(=O)N)C(=O)O |
Computed by PubChem (NCBI)