Products 1261924-78-0
CAS 1261924-78-0 appears in our catalog under these names: 2-(4-t-Butylsulfamoylphenyl)nicotinic acid, 96%, 2-(4-(N-(tert-Butyl)sulfamoyl)phenyl)nicotinic acid, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
2-[4-(tert-butylsulfamoyl)phenyl]pyridine-3-carboxylic acid (CAS 1261924-78-0) is a chemical compound with the molecular formula C16H18N2O4S and a molecular weight of 334.4 g/mol. IUPAC name: 2-[4-(tert-butylsulfamoyl)phenyl]pyridine-3-carboxylic acid. InChIKey: TYQOMMMJTCRLOB-UHFFFAOYSA-N.
| Molecular formula | C16H18N2O4S |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | 2-[4-(tert-butylsulfamoyl)phenyl]pyridine-3-carboxylic acid |
| InChIKey | TYQOMMMJTCRLOB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NS(=O)(=O)C1=CC=C(C=C1)C2=C(C=CC=N2)C(=O)O |
Computed by PubChem (NCBI)