CAS 857960-51-1 is the registry number for Benzylpenicillin Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,4S)-2-[(4R)-2-benzyl-5-oxo-4H-1,3-oxazol-4-yl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid (CAS 857960-51-1) is a chemical compound with the molecular formula C16H18N2O4S and a molecular weight of 334.4 g/mol. IUPAC name: (2R,4S)-2-[(4R)-2-benzyl-5-oxo-4H-1,3-oxazol-4-yl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid. InChIKey: HCRAFRIKPNRJFN-RWMBFGLXSA-N.
| Molecular formula | C16H18N2O4S |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | (2R,4S)-2-[(4R)-2-benzyl-5-oxo-4H-1,3-oxazol-4-yl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid |
| InChIKey | HCRAFRIKPNRJFN-RWMBFGLXSA-N |
| SMILES | CC1([C@@H](N[C@H](S1)[C@H]2C(=O)OC(=N2)CC3=CC=CC=C3)C(=O)O)C |
Computed by PubChem (NCBI)