Products 206659-00-9
CAS 206659-00-9 appears in our catalog under these names: 8-Anilino-1-naphthalenesulfonic acid ammonium salt hydrate, 97%, 8–Anilino–1–naphthalenesulfonic acid ammonium salt hydrate, 8-ANILINO-1-NAPHTHALENESULFONIC ACID,, 8-ANILINO-1-NAPHTHALENESULFONIC ACID, AM, Ammonium 8-(phenylamino)naphthalene-1-sulfonate xhydrate, 98%, 98%. Offered by: Combi-blocks, GLPBio, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 100g, 5g, 25g, 1g, 250G, 250mg, Get quote.
8-anilinonaphthalene-1-sulfonic acid;azane;hydrate (CAS 206659-00-9) is a chemical compound with the molecular formula C16H18N2O4S and a molecular weight of 334.4 g/mol. IUPAC name: 8-anilinonaphthalene-1-sulfonic acid;azane;hydrate. InChIKey: WCSOAGYLOWUTAG-UHFFFAOYSA-N.
| Molecular formula | C16H18N2O4S |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | 8-anilinonaphthalene-1-sulfonic acid;azane;hydrate |
| InChIKey | WCSOAGYLOWUTAG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC=CC3=C2C(=CC=C3)S(=O)(=O)O.N.O |
Computed by PubChem (NCBI)
Synonyms:
8-Anilinonaphthalene-1-sulfonic acid--ammonia--water (1/1/1), 8-anilinonaphthalene-1-sulfonic acid;azane;hydrate, 8-Anilino-1-naphthalenesulfonic acid ammonium salt hydrate, ANS, ammonium hydrate, orb2938858, ammonia;8-anilinonaphthalene-1-sulfonic acid;hydrate, 8-Anilino-1-naphthalenesulfonic acid ammonium salt hydrate, 97%