CAS 116-42-7 appears in our catalog under these names: Benzamide, n-[(4-aminophenyl)sulfonyl]-4-(1-methylethoxy)-, 95%, Sulfaproxiline/ 99.13% (existing batch purity), Sulfaproxiline (Sulfaproxylin), Sulfaproxiline, sulfaproxyline, 95%, 95%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 200mg.
N-(4-aminophenyl)sulfonyl-4-propan-2-yloxybenzamide (CAS 116-42-7) is a chemical compound with the molecular formula C16H18N2O4S and a molecular weight of 334.4 g/mol. IUPAC name: N-(4-aminophenyl)sulfonyl-4-propan-2-yloxybenzamide. InChIKey: FBFBRAFXKGRRHI-UHFFFAOYSA-N.
| Molecular formula | C16H18N2O4S |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | N-(4-aminophenyl)sulfonyl-4-propan-2-yloxybenzamide |
| InChIKey | FBFBRAFXKGRRHI-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC=C(C=C1)C(=O)NS(=O)(=O)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)