Products 736948-90-6
CAS 736948-90-6 appears in our catalog under these names: 5-(Morpholin-4-ylsulfonyl)-2-phenoxyaniline, 95%, 5-(Morpholine-4-sulfonyl)-2-phenoxyaniline. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
5-morpholin-4-ylsulfonyl-2-phenoxyaniline (CAS 736948-90-6) is a chemical compound with the molecular formula C16H18N2O4S and a molecular weight of 334.4 g/mol. IUPAC name: 5-morpholin-4-ylsulfonyl-2-phenoxyaniline. InChIKey: OPDRFNOUUAEXNH-UHFFFAOYSA-N.
| Molecular formula | C16H18N2O4S |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | 5-morpholin-4-ylsulfonyl-2-phenoxyaniline |
| InChIKey | OPDRFNOUUAEXNH-UHFFFAOYSA-N |
| SMILES | C1COCCN1S(=O)(=O)C2=CC(=C(C=C2)OC3=CC=CC=C3)N |
Computed by PubChem (NCBI)