Products 475272-62-9
CAS 475272-62-9 appears in our catalog under these names: 6–Methoxy–5–nitropicolinic acid, 6-Methoxy-5-nitropicolinic acid, 6-Methoxy-5-nitropicolinic acid 97%, 6-Methoxy-5-nitropicolinic acid, 97%, 97%, 6-Methoxy-5-nitropicolinic acid, 97%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 0,5g, 5g, 25g.
6-methoxy-5-nitropyridine-2-carboxylic acid (CAS 475272-62-9) is a chemical compound with the molecular formula C7H6N2O5 and a molecular weight of 198.13 g/mol. IUPAC name: 6-methoxy-5-nitropyridine-2-carboxylic acid. InChIKey: USBYKQLQDLTNGK-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O5 |
|---|---|
| Molecular weight | 198.13 g/mol |
| IUPAC name | 6-methoxy-5-nitropyridine-2-carboxylic acid |
| InChIKey | USBYKQLQDLTNGK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=N1)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)