Products 477552-94-6
CAS 477552-94-6 appears in our catalog under these names: Formoterol Impurity 6, ArforMoterol Tartrate Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
N-[2-hydroxy-5-[(1S)-1-hydroxyethyl]phenyl]formamide (CAS 477552-94-6) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: N-[2-hydroxy-5-[(1S)-1-hydroxyethyl]phenyl]formamide. InChIKey: VQYGKHXWJHEVRW-LURJTMIESA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | N-[2-hydroxy-5-[(1S)-1-hydroxyethyl]phenyl]formamide |
| InChIKey | VQYGKHXWJHEVRW-LURJTMIESA-N |
| SMILES | C[C@@H](C1=CC(=C(C=C1)O)NC=O)O |
Computed by PubChem (NCBI)