CAS 479-44-7 is the registry number for Ravenelin. Offered by: MedChemExpress. Available pack sizes: Get quote.
1,4,8-trihydroxy-3-methylxanthen-9-one (CAS 479-44-7) is a chemical compound with the molecular formula C14H10O5 and a molecular weight of 258.23 g/mol. IUPAC name: 1,4,8-trihydroxy-3-methylxanthen-9-one. InChIKey: GFYRPPGRPOFGOW-UHFFFAOYSA-N.
| Molecular formula | C14H10O5 |
|---|---|
| Molecular weight | 258.23 g/mol |
| IUPAC name | 1,4,8-trihydroxy-3-methylxanthen-9-one |
| InChIKey | GFYRPPGRPOFGOW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1O)OC3=CC=CC(=C3C2=O)O)O |
Computed by PubChem (NCBI)