CAS 480438-54-8 appears in our catalog under these names: 3–Fluoro–4–isopropoxyphenylboronic acid (contains varying amounts of Anhydride), 3-Fluoro-4-isopropoxyphenylboronicacid, 98%, 98%, 3-Fluoro-4-isopropoxyphenylboronic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 100mg, 250mg.
(3-fluoro-4-propan-2-yloxyphenyl)boronic acid (CAS 480438-54-8) is a chemical compound with the molecular formula C9H12BFO3 and a molecular weight of 198.00 g/mol. IUPAC name: (3-fluoro-4-propan-2-yloxyphenyl)boronic acid. InChIKey: XZQQJUVWZYJYPN-UHFFFAOYSA-N.
| Molecular formula | C9H12BFO3 |
|---|---|
| Molecular weight | 198.00 g/mol |
| IUPAC name | (3-fluoro-4-propan-2-yloxyphenyl)boronic acid |
| InChIKey | XZQQJUVWZYJYPN-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OC(C)C)F)(O)O |
Computed by PubChem (NCBI)