Products 480438-63-9
CAS 480438-63-9 appears in our catalog under these names: 5-Fluoro-2-isopropoxyphenylboronic acid, 98%, (5-Fluoro-2-isopropoxyphenyl)boronic acid 98%, (5-Fluoro-2-isopropoxyphenyl)boronic acid, 97%, 97%, (5-Fluoro-2-isopropoxyphenyl)boronic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 100mg.
(5-fluoro-2-propan-2-yloxyphenyl)boronic acid (CAS 480438-63-9) is a chemical compound with the molecular formula C9H12BFO3 and a molecular weight of 198.00 g/mol. IUPAC name: (5-fluoro-2-propan-2-yloxyphenyl)boronic acid. InChIKey: HURKIYCPAQBJFZ-UHFFFAOYSA-N.
| Molecular formula | C9H12BFO3 |
|---|---|
| Molecular weight | 198.00 g/mol |
| IUPAC name | (5-fluoro-2-propan-2-yloxyphenyl)boronic acid |
| InChIKey | HURKIYCPAQBJFZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)F)OC(C)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
5-Fluoro-2-isopropoxyphenylboronic acid, (5-Fluoro-2-isopropoxyphenyl)boronic acid, (5-fluoro-2-propan-2-yloxyphenyl)boronic acid, (5-Fluoro-2-isopropoxyphenyl)boronicacid, (5-fluoro-2-isopropoxy-phenyl)boronic acid, {5-Fluoro-2-[(propan-2-yl)oxy]phenyl}boronic acid, 5-Fluoro-2-isopropoxyphenylboronic acid(contains varying amounts of Anhydride)