Products 48150-45-4
CAS 48150-45-4 appears in our catalog under these names: 3–Methacrylamidophenylboronic Acid (contains varying amounts of Anhydride), 3-Methacrylamidophenylboronic Acid (contains varying amounts of Anhydride), (3-Methacrylamidophenyl)boronic acid 97%, (3-Methacrylamidophenyl)boronic acid, 97%, 97%, (3-Methacrylamidophenyl)boronic acid, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 250mg, 10g, 100g.
[3-(2-methylprop-2-enoylamino)phenyl]boronic acid (CAS 48150-45-4) is a chemical compound with the molecular formula C10H12BNO3 and a molecular weight of 205.02 g/mol. IUPAC name: [3-(2-methylprop-2-enoylamino)phenyl]boronic acid. InChIKey: GBBUBIKYAQLESK-UHFFFAOYSA-N.
| Molecular formula | C10H12BNO3 |
|---|---|
| Molecular weight | 205.02 g/mol |
| IUPAC name | [3-(2-methylprop-2-enoylamino)phenyl]boronic acid |
| InChIKey | GBBUBIKYAQLESK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)NC(=O)C(=C)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
3-Methacrylamidophenylboronic acid, m-Methacrylamidophenylboronic acid, (3-Methacrylamidophenyl)boronic acid, 3-Methacrylamido phenyl boronic acid, [3-(2-methylprop-2-enoylamino)phenyl]boronic acid, [3-(Methacryloylamino)phenyl]boronic acid, 3-Methacrylamido phenylboronic acid, [3-(2-methylprop-2-enamido)phenyl]boronic acid, Boronic acid, [3-[(2-methyl-1-oxo-2-propenyl)amino]phenyl]-, Boric acid gel