Products 4818-19-3
CAS 4818-19-3 appears in our catalog under these names: IIIM-1270, 98.78%, 5-[(2,4-Dimethylphenyl)methylene]-2,4-thiazolidinedione, 95%. Offered by: MedChemExpress, Chemat. Available pack sizes: 25 mg, 50 mg, 5 mg, 10 mg, 50mg, 100mg.
(5Z)-5-[(2,4-dimethylphenyl)methylidene]-1,3-thiazolidine-2,4-dione (CAS 4818-19-3) is a chemical compound with the molecular formula C12H11NO2S and a molecular weight of 233.29 g/mol. IUPAC name: (5Z)-5-[(2,4-dimethylphenyl)methylidene]-1,3-thiazolidine-2,4-dione. InChIKey: KFYPWWDPFGBNDO-POHAHGRESA-N.
| Molecular formula | C12H11NO2S |
|---|---|
| Molecular weight | 233.29 g/mol |
| IUPAC name | (5Z)-5-[(2,4-dimethylphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| InChIKey | KFYPWWDPFGBNDO-POHAHGRESA-N |
| SMILES | CC1=CC(=C(C=C1)/C=C\2/C(=O)NC(=O)S2)C |
Computed by PubChem (NCBI)