Products 482628-23-9
CAS 482628-23-9 appears in our catalog under these names: 3,5-dimethoxy-4-fluorophenylboronic acid, (4-Fluoro-3,5-dimethoxyphenyl)boronic acid 95%, (4-Fluoro-3,5-dimethoxyphenyl)boronic acid, 97%, 97%, (4-Fluoro-3,5-dimethoxyphenyl)boronic acid, 95%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 250mg, 1g, 5g, 100mg.
(4-fluoro-3,5-dimethoxyphenyl)boronic acid (CAS 482628-23-9) is a chemical compound with the molecular formula C8H10BFO4 and a molecular weight of 199.97 g/mol. IUPAC name: (4-fluoro-3,5-dimethoxyphenyl)boronic acid. InChIKey: YXCHYZQCQRCTOC-UHFFFAOYSA-N.
| Molecular formula | C8H10BFO4 |
|---|---|
| Molecular weight | 199.97 g/mol |
| IUPAC name | (4-fluoro-3,5-dimethoxyphenyl)boronic acid |
| InChIKey | YXCHYZQCQRCTOC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)OC)F)OC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(4-Fluoro-3,5-dimethoxyphenyl)boronic acid, 3,5-dimethoxy-4-fluorophenylboronic acid, Boronic acid, (4-fluoro-3,5-dimethoxyphenyl)-, 4-fluoro-3,5-dimethoxyphenylboronic acid, (4-fluoro-3,5-dimethoxy-phenyl)boronic acid, (4-Fluoro-3,5-dimethoxyphenyl)boronicacid, B-(4-Fluoro-3,5-dimethoxyphenyl)boronic acid, Boronic acid, B-(4-fluoro-3,5-dimethoxyphenyl)-