Products 483303-97-5
CAS 483303-97-5 is the registry number for Paracetamol Impurity 24. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-[acetyl(methyl)amino]-2-methoxybenzoate (CAS 483303-97-5) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. IUPAC name: methyl 4-[acetyl(methyl)amino]-2-methoxybenzoate. InChIKey: BZIYXBCSQFDYNE-UHFFFAOYSA-N.
| Molecular formula | C12H15NO4 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | methyl 4-[acetyl(methyl)amino]-2-methoxybenzoate |
| InChIKey | BZIYXBCSQFDYNE-UHFFFAOYSA-N |
| SMILES | CC(=O)N(C)C1=CC(=C(C=C1)C(=O)OC)OC |
Computed by PubChem (NCBI)