CAS 4846-95-1 is the registry number for Baclofen Impurity 20. Offered by: Chemat Brand. Available pack sizes: on request.
4-amino-3-(3,4-dichlorophenyl)butanoic acid (CAS 4846-95-1) is a chemical compound with the molecular formula C10H11Cl2NO2 and a molecular weight of 248.10 g/mol. IUPAC name: 4-amino-3-(3,4-dichlorophenyl)butanoic acid. InChIKey: XISRLVACEZPSFU-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2NO2 |
|---|---|
| Molecular weight | 248.10 g/mol |
| IUPAC name | 4-amino-3-(3,4-dichlorophenyl)butanoic acid |
| InChIKey | XISRLVACEZPSFU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(CC(=O)O)CN)Cl)Cl |
Computed by PubChem (NCBI)