CAS 4856-87-5 appears in our catalog under these names: 1,6-Bismaleimidohexane, 95%, 1,1'–(Hexane–1,6–diyl)bis(1H–pyrrole–2,5–dione), 1,6-Bismaleimidohexane, 97% , 1,6-Bis(maleimido)hexane, >97.0%(HPLC)(N), 1,6-Bismaleimidohexane 98%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: 100mg, 500mg, 250mg, 1g, 50MG, 50 mg, 100 mg, 25 mg.
1-[6-(2,5-dioxopyrrol-1-yl)hexyl]pyrrole-2,5-dione (CAS 4856-87-5) is a chemical compound with the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. IUPAC name: 1-[6-(2,5-dioxopyrrol-1-yl)hexyl]pyrrole-2,5-dione. InChIKey: PYVHLZLQVWXBDZ-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O4 |
|---|---|
| Molecular weight | 276.29 g/mol |
| IUPAC name | 1-[6-(2,5-dioxopyrrol-1-yl)hexyl]pyrrole-2,5-dione |
| InChIKey | PYVHLZLQVWXBDZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCCCCCN2C(=O)C=CC2=O |
Computed by PubChem (NCBI)