CAS 4900-26-9 appears in our catalog under these names: 5-(2-Amino-ethyl)-2-hydroxy-benzoic acid HBr, 95%, 5–(2–Aminoethyl)–2–hydroxybenzoic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 50mg.
5-(2-aminoethyl)-2-hydroxybenzoic acid (CAS 4900-26-9) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 5-(2-aminoethyl)-2-hydroxybenzoic acid. InChIKey: UVHVULDKNLJNRZ-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 5-(2-aminoethyl)-2-hydroxybenzoic acid |
| InChIKey | UVHVULDKNLJNRZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CCN)C(=O)O)O |
Computed by PubChem (NCBI)