CAS 492-86-4 appears in our catalog under these names: 4-Chloromandelic acid, 4-Chloromandelic acid, 98% , 4-Chloromandelic acid 98%, 4-Chloromandelic acid, 98%, 4–Chloro–DL–mandelic Acid. Offered by: Biosynth, Thermo Scientific (Alfa Aesar), Ambeed, GLPBio, Fluorochem. Available pack sizes: 250g, 100g, 500g, 1000g, 5g, 25g, 1kg, 1g.
2-(4-chlorophenyl)-2-hydroxyacetic acid (CAS 492-86-4) is a chemical compound with the molecular formula C8H7ClO3 and a molecular weight of 186.59 g/mol. IUPAC name: 2-(4-chlorophenyl)-2-hydroxyacetic acid. InChIKey: BWSFWXSSALIZAU-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO3 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-2-hydroxyacetic acid |
| InChIKey | BWSFWXSSALIZAU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(=O)O)O)Cl |
Computed by PubChem (NCBI)