Products 7138-34-3
CAS 7138-34-3 is the registry number for 4-Chloro-DL-mandelic Acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g.
2-(4-chlorophenyl)-2-hydroxyacetic acid (CAS 7138-34-3) is a chemical compound with the molecular formula C8H7ClO3 and a molecular weight of 186.59 g/mol. IUPAC name: 2-(4-chlorophenyl)-2-hydroxyacetic acid. InChIKey: BWSFWXSSALIZAU-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO3 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-2-hydroxyacetic acid |
| InChIKey | BWSFWXSSALIZAU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(=O)O)O)Cl |
Computed by PubChem (NCBI)
Synonyms:
Para-chloromandelic acid, Benzeneacetic acid, 4-chloro-.alpha.-hydroxy-, Benzeneacetic acid, 4-chloro-alpha-hydroxy-, 4-Chloro-.alpha.-hydroxybenzeneethanoic acid, 4-Chloro-alpha-hydroxybenzeneethanoic acid, BWSFWXSSALIZAU-UHFFFAOYSA-N, 2-(4-chlorophenyl)-2-hydroxyacetic acid, p-Chloromandelic acid, 4-Chloro-DL-mandelic acid, (4-Chlorophenyl)(hydroxy)acetic acid