CAS 76496-63-4 appears in our catalog under these names: (S)-2-(4-Chlorophenyl)-2-hydroxyacetic acid, 98%, (S)-2-(4-Chlorophenyl)-2-hydroxyacetic Acid, >95% (HPLC), (S)-2-(4-Chlorophenyl)-2-hydroxyacetic acid, 98%, 98%. Offered by: Fluorochem, Ambeed, TRC, Chemat. Available pack sizes: 1g, 5g, 250mg, 10g, 25g, 100mg, 500mg, 50mg.
(2S)-2-(4-chlorophenyl)-2-hydroxyacetic acid (CAS 76496-63-4) is a chemical compound with the molecular formula C8H7ClO3 and a molecular weight of 186.59 g/mol. IUPAC name: (2S)-2-(4-chlorophenyl)-2-hydroxyacetic acid. InChIKey: BWSFWXSSALIZAU-ZETCQYMHSA-N.
| Molecular formula | C8H7ClO3 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | (2S)-2-(4-chlorophenyl)-2-hydroxyacetic acid |
| InChIKey | BWSFWXSSALIZAU-ZETCQYMHSA-N |
| SMILES | C1=CC(=CC=C1[C@@H](C(=O)O)O)Cl |
Computed by PubChem (NCBI)