Products 492-94-4
CAS 492-94-4 appears in our catalog under these names: Furil, 95%, Alpha-Furil, >95% (HPLC), Furil, α-Furil/ 98+%, 2,2'-Furil, 98% . Offered by: Combi-blocks, TRC, GLPBio, Chemat, Thermo Scientific (Alfa Aesar). Available pack sizes: 25g, 5g, 1g, 10g, 2,5g, 100g, 50g.
1,2-bis(furan-2-yl)ethane-1,2-dione (CAS 492-94-4) is a chemical compound with the molecular formula C10H6O4 and a molecular weight of 190.15 g/mol. IUPAC name: 1,2-bis(furan-2-yl)ethane-1,2-dione. InChIKey: SXPUVBFQXJHYNS-UHFFFAOYSA-N.
| Molecular formula | C10H6O4 |
|---|---|
| Molecular weight | 190.15 g/mol |
| IUPAC name | 1,2-bis(furan-2-yl)ethane-1,2-dione |
| InChIKey | SXPUVBFQXJHYNS-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C(=O)C(=O)C2=CC=CO2 |
Computed by PubChem (NCBI)