CAS 51751-34-9 appears in our catalog under these names: 4-Hydroxy-2-oxo-2h-chromene-3-carbaldehyde, 95%, 4-Hydroxy-3-formylcoumarin. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 1000mg, 2000mg, 5000mg.
4-hydroxy-2-oxochromene-3-carbaldehyde (CAS 51751-34-9) is a chemical compound with the molecular formula C10H6O4 and a molecular weight of 190.15 g/mol. IUPAC name: 4-hydroxy-2-oxochromene-3-carbaldehyde. InChIKey: WNIIGYLAWCFYOW-UHFFFAOYSA-N.
| Molecular formula | C10H6O4 |
|---|---|
| Molecular weight | 190.15 g/mol |
| IUPAC name | 4-hydroxy-2-oxochromene-3-carbaldehyde |
| InChIKey | WNIIGYLAWCFYOW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(C(=O)O2)C=O)O |
Computed by PubChem (NCBI)