CAS 858442-67-8 is the registry number for Apremilast Impurity 128. Offered by: Chemat Brand. Available pack sizes: on request.
5-acetyl-2-benzofuran-1,3-dione (CAS 858442-67-8) is a chemical compound with the molecular formula C10H6O4 and a molecular weight of 190.15 g/mol. IUPAC name: 5-acetyl-2-benzofuran-1,3-dione. InChIKey: KRZVTRKUXAQDIA-UHFFFAOYSA-N.
| Molecular formula | C10H6O4 |
|---|---|
| Molecular weight | 190.15 g/mol |
| IUPAC name | 5-acetyl-2-benzofuran-1,3-dione |
| InChIKey | KRZVTRKUXAQDIA-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)C(=O)OC2=O |
Computed by PubChem (NCBI)