CAS 7734-80-7 appears in our catalog under these names: 2-Oxo-2h-chromene-6-carboxylic acid, 98%, 2-Oxo-2H-chromene-6-carboxylic acid, 2-Oxo-2H-chromene-6-carboxylic acid, 98%, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg, 0,5g, 2g, 10g, 100mg, 25g.
2-oxochromene-6-carboxylic acid (CAS 7734-80-7) is a chemical compound with the molecular formula C10H6O4 and a molecular weight of 190.15 g/mol. IUPAC name: 2-oxochromene-6-carboxylic acid. InChIKey: GEFDYGOYVXEKBE-UHFFFAOYSA-N.
| Molecular formula | C10H6O4 |
|---|---|
| Molecular weight | 190.15 g/mol |
| IUPAC name | 2-oxochromene-6-carboxylic acid |
| InChIKey | GEFDYGOYVXEKBE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=O)O2)C=C1C(=O)O |
Computed by PubChem (NCBI)