CAS 15868-29-8 appears in our catalog under these names: 1-Oxo-1h-isochromene-4-carboxylic acid, 95%, 1-Oxo-1H-isochromene-4-carboxylic Acid, 1-Oxo-1H-isochromene-4-carboxylic acid, 95+%. Offered by: Combi-blocks, TRC, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 100mg, 10mg, 50mg, 0,5g.
1-oxoisochromene-4-carboxylic acid (CAS 15868-29-8) is a chemical compound with the molecular formula C10H6O4 and a molecular weight of 190.15 g/mol. IUPAC name: 1-oxoisochromene-4-carboxylic acid. InChIKey: BURVSGFUKWYAEU-UHFFFAOYSA-N.
| Molecular formula | C10H6O4 |
|---|---|
| Molecular weight | 190.15 g/mol |
| IUPAC name | 1-oxoisochromene-4-carboxylic acid |
| InChIKey | BURVSGFUKWYAEU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=COC2=O)C(=O)O |
Computed by PubChem (NCBI)