CAS 605-37-8 appears in our catalog under these names: 2, 3-Dihydroxy-1,4-Naphthoquinone, 2,3-Dihydroxy-1,4-naphthoquinone, 2,3-Dihydroxynaphthalene-1,4-dione 97%. Offered by: Chemat Brand, TRC, Ambeed. Available pack sizes: on request, 10mg, 50mg, 5mg, 250mg, 1g, 5g.
2,3-dihydroxynaphthalene-1,4-dione (CAS 605-37-8) is a chemical compound with the molecular formula C10H6O4 and a molecular weight of 190.15 g/mol. IUPAC name: 2,3-dihydroxynaphthalene-1,4-dione. InChIKey: BVQUETZBXIMAFZ-UHFFFAOYSA-N.
| Molecular formula | C10H6O4 |
|---|---|
| Molecular weight | 190.15 g/mol |
| IUPAC name | 2,3-dihydroxynaphthalene-1,4-dione |
| InChIKey | BVQUETZBXIMAFZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(=C(C2=O)O)O |
Computed by PubChem (NCBI)