CAS 87639-56-3 appears in our catalog under these names: 4-Ethynylbenzene-1,2-dioic acid, 95%, 4-Ethynylphthalic acid, 97%, 4-Ethynylphthalic acid 96%, 4-ETHYNYLBENZENE-1,2-DIOIC ACID, 96%, 96%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg.
4-ethynylphthalic acid (CAS 87639-56-3) is a chemical compound with the molecular formula C10H6O4 and a molecular weight of 190.15 g/mol. IUPAC name: 4-ethynylphthalic acid. InChIKey: GWDWBZQHNHBODA-UHFFFAOYSA-N.
| Molecular formula | C10H6O4 |
|---|---|
| Molecular weight | 190.15 g/mol |
| IUPAC name | 4-ethynylphthalic acid |
| InChIKey | GWDWBZQHNHBODA-UHFFFAOYSA-N |
| SMILES | C#CC1=CC(=C(C=C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)