Products 496052-55-2
CAS 496052-55-2 appears in our catalog under these names: 3,5-Dichloro-4-(trifluoromethyl)benzenamine, 97%, 3,5-Dichloro-4-(trifluoromethyl)aniline, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
3,5-dichloro-4-(trifluoromethyl)aniline (CAS 496052-55-2) is a chemical compound with the molecular formula C7H4Cl2F3N and a molecular weight of 230.01 g/mol. IUPAC name: 3,5-dichloro-4-(trifluoromethyl)aniline. InChIKey: LOVGLWZIYWMBLT-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2F3N |
|---|---|
| Molecular weight | 230.01 g/mol |
| IUPAC name | 3,5-dichloro-4-(trifluoromethyl)aniline |
| InChIKey | LOVGLWZIYWMBLT-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)C(F)(F)F)Cl)N |
Computed by PubChem (NCBI)