CAS 497-56-3 is the registry number for 3,5-Dinitro-o-cresol. Offered by: TRC. Available pack sizes: 2,5g.
2-methyl-3,5-dinitrophenol (CAS 497-56-3) is a chemical compound with the molecular formula C7H6N2O5 and a molecular weight of 198.13 g/mol. IUPAC name: 2-methyl-3,5-dinitrophenol. InChIKey: KSHJAFFDLKPUMT-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O5 |
|---|---|
| Molecular weight | 198.13 g/mol |
| IUPAC name | 2-methyl-3,5-dinitrophenol |
| InChIKey | KSHJAFFDLKPUMT-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1O)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)