CAS 500023-37-0 appears in our catalog under these names: 2,4-Dimethoxybenzaldehyde oxime, 95%, 2,4-Dimethoxybenzaldehyde oxime. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 25g, 5g, 10g.
(NE)-N-[(2,4-dimethoxyphenyl)methylidene]hydroxylamine (CAS 500023-37-0) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: (NE)-N-[(2,4-dimethoxyphenyl)methylidene]hydroxylamine. InChIKey: SFDRVCQSVTYHLU-UXBLZVDNSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | (NE)-N-[(2,4-dimethoxyphenyl)methylidene]hydroxylamine |
| InChIKey | SFDRVCQSVTYHLU-UXBLZVDNSA-N |
| SMILES | COC1=CC(=C(C=C1)/C=N/O)OC |
Computed by PubChem (NCBI)