CAS 500546-49-6 is the registry number for 2-Methyl-5-nitroisoindoline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methyl-5-nitro-1,3-dihydroisoindole (CAS 500546-49-6) is a chemical compound with the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. IUPAC name: 2-methyl-5-nitro-1,3-dihydroisoindole. InChIKey: KBRUQEDLLNRMKU-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | 2-methyl-5-nitro-1,3-dihydroisoindole |
| InChIKey | KBRUQEDLLNRMKU-UHFFFAOYSA-N |
| SMILES | CN1CC2=C(C1)C=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)