Products 500590-51-2
CAS 500590-51-2 appears in our catalog under these names: 3-Acetamido-5-(trifluoromethyl)benzoic acid, 3-Acetamido-5-(trifluoromethyl)benzoic acid, 95%. Offered by: Biosynth, Ambeed, Chemat, BLDpharm. Available pack sizes: 0,5g, 5g, 250mg, 1g, 100mg.
3-acetamido-5-(trifluoromethyl)benzoic acid (CAS 500590-51-2) is a chemical compound with the molecular formula C10H8F3NO3 and a molecular weight of 247.17 g/mol. IUPAC name: 3-acetamido-5-(trifluoromethyl)benzoic acid. InChIKey: UEGUKMUUDSGPDJ-UHFFFAOYSA-N.
| Molecular formula | C10H8F3NO3 |
|---|---|
| Molecular weight | 247.17 g/mol |
| IUPAC name | 3-acetamido-5-(trifluoromethyl)benzoic acid |
| InChIKey | UEGUKMUUDSGPDJ-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=CC(=C1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)