Products 500782-71-8
CAS 500782-71-8 is the registry number for tert-Butyl 4-(chloromethyl)-1H-imidazole-1-carboxylate, 95+%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 4-(chloromethyl)imidazole-1-carboxylate (CAS 500782-71-8) is a chemical compound with the molecular formula C9H13ClN2O2 and a molecular weight of 216.66 g/mol. IUPAC name: tert-butyl 4-(chloromethyl)imidazole-1-carboxylate. InChIKey: WEVUSNXEJVVWOD-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2O2 |
|---|---|
| Molecular weight | 216.66 g/mol |
| IUPAC name | tert-butyl 4-(chloromethyl)imidazole-1-carboxylate |
| InChIKey | WEVUSNXEJVVWOD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(N=C1)CCl |
Computed by PubChem (NCBI)