CAS 50442-48-3 is the registry number for 1-Acenaphthenol-d3. Offered by: TRC. Available pack sizes: 10mg.
1,2,2-trideuterioacenaphthylen-1-ol (CAS 50442-48-3) is a chemical compound with the molecular formula C12H10O and a molecular weight of 173.22 g/mol. IUPAC name: 1,2,2-trideuterioacenaphthylen-1-ol. InChIKey: MXUCIEHYJYRTLT-XGWWUZNLSA-N.
| Molecular formula | C12H10O |
|---|---|
| Molecular weight | 173.22 g/mol |
| IUPAC name | 1,2,2-trideuterioacenaphthylen-1-ol |
| InChIKey | MXUCIEHYJYRTLT-XGWWUZNLSA-N |
| SMILES | [2H]C1(C2=CC=CC3=C2C(=CC=C3)C1([2H])O)[2H] |
Computed by PubChem (NCBI)