CAS 50502-78-8 is the registry number for 8-Hydroxy-3,4-dihydrobenzo[f][1,4]oxazepin-5(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-hydroxy-3,4-dihydro-2H-1,4-benzoxazepin-5-one (CAS 50502-78-8) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 8-hydroxy-3,4-dihydro-2H-1,4-benzoxazepin-5-one. InChIKey: UPEPOORKWSYULD-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | 8-hydroxy-3,4-dihydro-2H-1,4-benzoxazepin-5-one |
| InChIKey | UPEPOORKWSYULD-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=CC(=C2)O)C(=O)N1 |
Computed by PubChem (NCBI)