Products 50706-00-8
CAS 50706-00-8 is the registry number for Edaravone Impurity 30. Offered by: Chemat Brand. Available pack sizes: on request.
(2Z)-2-(phenylhydrazinylidene)propanoic acid (CAS 50706-00-8) is a chemical compound with the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. IUPAC name: (2Z)-2-(phenylhydrazinylidene)propanoic acid. InChIKey: CSTSUTMIORLRIN-YFHOEESVSA-N.
| Molecular formula | C9H10N2O2 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | (2Z)-2-(phenylhydrazinylidene)propanoic acid |
| InChIKey | CSTSUTMIORLRIN-YFHOEESVSA-N |
| SMILES | C/C(=N/NC1=CC=CC=C1)/C(=O)O |
Computed by PubChem (NCBI)