Products 50727-04-3
CAS 50727-04-3 appears in our catalog under these names: 5-Methoxyisoindoline-1,3-dione, 96%, 5–Methoxyisoindoline–1，3–dione, 5-Methoxyisoindoline-1,3-dione 97%, 5-Methoxyisoindoline-1,3-Dione, 97%, 97%, 5-Methoxyisoindoline-1,3-dione, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
5-methoxyisoindole-1,3-dione (CAS 50727-04-3) is a chemical compound with the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. IUPAC name: 5-methoxyisoindole-1,3-dione. InChIKey: BIANPEOCBJDOEM-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 5-methoxyisoindole-1,3-dione |
| InChIKey | BIANPEOCBJDOEM-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=O)NC2=O |
Computed by PubChem (NCBI)