CAS 50727-05-4 appears in our catalog under these names: 4-Ethoxyphthalimide, 5-Ethoxy-2,3-dihydro-1H-isoindole-1,3-dione, 95%. Offered by: TRC, AmBeed. Available pack sizes: 2,5g, 1g.
5-ethoxyisoindole-1,3-dione (CAS 50727-05-4) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 5-ethoxyisoindole-1,3-dione. InChIKey: TVSKCUHMZOIRNW-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 5-ethoxyisoindole-1,3-dione |
| InChIKey | TVSKCUHMZOIRNW-UHFFFAOYSA-N |
| SMILES | CCOC1=CC2=C(C=C1)C(=O)NC2=O |
Computed by PubChem (NCBI)