CAS 50779-85-6 is the registry number for 2-Amino-3,4-dimethoxybenzaldehyde, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-3,4-dimethoxybenzaldehyde (CAS 50779-85-6) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 2-amino-3,4-dimethoxybenzaldehyde. InChIKey: ZISIRLHUSIOGPX-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 2-amino-3,4-dimethoxybenzaldehyde |
| InChIKey | ZISIRLHUSIOGPX-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)C=O)N)OC |
Computed by PubChem (NCBI)