CAS 50917-29-8 is the registry number for 3-Amino-2,6-dichlorobenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-amino-2,6-dichlorobenzoic acid (CAS 50917-29-8) is a chemical compound with the molecular formula C7H5Cl2NO2 and a molecular weight of 206.02 g/mol. IUPAC name: 3-amino-2,6-dichlorobenzoic acid. InChIKey: SVMCPPLCIXHWBS-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO2 |
|---|---|
| Molecular weight | 206.02 g/mol |
| IUPAC name | 3-amino-2,6-dichlorobenzoic acid |
| InChIKey | SVMCPPLCIXHWBS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1N)Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)