CAS 50917-32-3 is the registry number for 5-Amino-2,3-dichlorobenzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-amino-2,3-dichlorobenzoic acid (CAS 50917-32-3) is a chemical compound with the molecular formula C7H5Cl2NO2 and a molecular weight of 206.02 g/mol. IUPAC name: 5-amino-2,3-dichlorobenzoic acid. InChIKey: RYCVUGZLAQJJLC-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO2 |
|---|---|
| Molecular weight | 206.02 g/mol |
| IUPAC name | 5-amino-2,3-dichlorobenzoic acid |
| InChIKey | RYCVUGZLAQJJLC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)Cl)Cl)N |
Computed by PubChem (NCBI)