Products 50917-32-3

CAS 50917-32-3 is the registry number for 5-Amino-2,3-dichlorobenzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

5-amino-2,3-dichlorobenzoic acid (CAS 50917-32-3) is a chemical compound with the molecular formula C7H5Cl2NO2 and a molecular weight of 206.02 g/mol. IUPAC name: 5-amino-2,3-dichlorobenzoic acid. InChIKey: RYCVUGZLAQJJLC-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5Cl2NO2
Molecular weight206.02 g/mol
IUPAC name5-amino-2,3-dichlorobenzoic acid
InChIKeyRYCVUGZLAQJJLC-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1C(=O)O)Cl)Cl)N

Computed by PubChem (NCBI)