CAS 5105-78-2 appears in our catalog under these names: N-Benzyloxycarbonyl-Gamma-aminobutyric Acid, Z–GABA–OH,Z–gama–Abu–OH, N-Carbobenzoxy-4-aminobutyric Acid, >98.0%(T), Cbz-GABA-OH 98%, N-Cbz-4-aminobutanoic Acid, 98%, 98%. Offered by: TRC, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 25mg, 500mg, 5g, 100g, 25g, 1g, 10g, 500g.
4-(phenylmethoxycarbonylamino)butanoic acid (CAS 5105-78-2) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. IUPAC name: 4-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: STQMDRQJSNKUAW-UHFFFAOYSA-N.
| Molecular formula | C12H15NO4 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | 4-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | STQMDRQJSNKUAW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCCCC(=O)O |
Computed by PubChem (NCBI)