CAS 51116-92-8 is the registry number for Methyl 4,6-Dimethoxysalicylate. Offered by: TRC. Available pack sizes: 10g.
Methyl 2-hydroxy-4,6-dimethoxybenzoate (CAS 51116-92-8) is a chemical compound with the molecular formula C10H12O5 and a molecular weight of 212.20 g/mol. IUPAC name: methyl 2-hydroxy-4,6-dimethoxybenzoate. InChIKey: FLOLRRPLSHXXMQ-UHFFFAOYSA-N.
| Molecular formula | C10H12O5 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | methyl 2-hydroxy-4,6-dimethoxybenzoate |
| InChIKey | FLOLRRPLSHXXMQ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)OC)C(=O)OC)O |
Computed by PubChem (NCBI)